EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O7 |
| Net Charge | 0 |
| Average Mass | 346.335 |
| Monoisotopic Mass | 346.10525 |
| SMILES | [H][C@@]12O[C@]1([H])[C@H](O)[C@]1(C)C(=O)O[C@]3([H])[C@H]4O[C@@]45C(=CC(=O)O[C@@H]5C=C)[C@]2(C)[C@]13[H] |
| InChI | InChI=1S/C18H18O7/c1-4-7-18-6(5-8(19)22-7)16(2)11-9(14(18)25-18)24-15(21)17(11,3)12(20)10-13(16)23-10/h4-5,7,9-14,20H,1H2,2-3H3/t7-,9+,10-,11-,12+,13-,14-,16-,17-,18-/m1/s1 |
| InChIKey | VLRYBJQMQSJMHB-UNJPOVPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podocarpus latifolius (ncbitaxon:120620) | root (BTO:0001188) | PubMed (21306129) | Previous component: root bark; CH2Cl2-MeOH(1:1) extract of dried, ground root bark |
| Roles Classification |
|---|
| Biological Roles: | AP-1 antagonist An antogonist that interferes with the action of activator protein 1 (AP-1). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inumakilactone B (CHEBI:68294) has role AP-1 antagonist (CHEBI:67199) |
| inumakilactone B (CHEBI:68294) has role metabolite (CHEBI:25212) |
| inumakilactone B (CHEBI:68294) is a diterpene lactone (CHEBI:49193) |
| inumakilactone B (CHEBI:68294) is a epoxide (CHEBI:32955) |
| inumakilactone B (CHEBI:68294) is a organic heterohexacyclic compound (CHEBI:51914) |
| inumakilactone B (CHEBI:68294) is a γ-lactone (CHEBI:37581) |
| inumakilactone B (CHEBI:68294) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1aR,1bS,3aR,3bR,4R,4aR,5aS,5bS,9R,9aR)-9-ethenyl-4-hydroxy-3a,5b-dimethyl-1a,1b,3a,3b,4,4a,5a,5b-octahydro-3H,7H-oxireno[5,6][2]benzofuro[7,1-fg]oxireno[i]isochromene-3,7-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19894434 | Reaxys |
| Citations |
|---|