EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O4 |
| Net Charge | 0 |
| Average Mass | 316.397 |
| Monoisotopic Mass | 316.16746 |
| SMILES | [H][C@@]12[C@@]3([H])C=C4C(=CC(=O)O[C@@H]4C(C)C)[C@@]1(C)CCC[C@]2(C)C(=O)O3 |
| InChI | InChI=1S/C19H24O4/c1-10(2)15-11-8-13-16-18(3,12(11)9-14(20)23-15)6-5-7-19(16,4)17(21)22-13/h8-10,13,15-16H,5-7H2,1-4H3/t13-,15-,16-,18-,19+/m1/s1 |
| InChIKey | DYJDPNXKUMPXEJ-DZLVSBGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podocarpus latifolius (ncbitaxon:120620) | root (BTO:0001188) | PubMed (21306129) | Previous component: root bark; CH2Cl2-MeOH(1:1) extract of dried, ground root bark |
| Roles Classification |
|---|
| Biological Roles: | AP-1 antagonist An antogonist that interferes with the action of activator protein 1 (AP-1). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nagilactone F (CHEBI:68293) has role AP-1 antagonist (CHEBI:67199) |
| nagilactone F (CHEBI:68293) has role metabolite (CHEBI:25212) |
| nagilactone F (CHEBI:68293) is a diterpene lactone (CHEBI:49193) |
| nagilactone F (CHEBI:68293) is a organic heterotetracyclic compound (CHEBI:38163) |
| nagilactone F (CHEBI:68293) is a γ-lactone (CHEBI:37581) |
| nagilactone F (CHEBI:68293) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (3aS,5aR,7R,10bS,10cR)-3a,10b-dimethyl-7-(propan-2-yl)-1,2,3,3a,5a,7,10b,10c-octahydro-4H,9H-[2]benzofuro[7,1-fg]isochromene-4,9-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1399292 | Reaxys |
| CAS:36912-00-2 | ChemIDplus |
| Citations |
|---|