EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O2 |
| Net Charge | 0 |
| Average Mass | 300.442 |
| Monoisotopic Mass | 300.20893 |
| SMILES | [H][C@@]12CCc3c(C(C)C)ccc(O)c3[C@@]1(C)CCC[C@]2(C)C=O |
| InChI | InChI=1S/C20H28O2/c1-13(2)14-6-8-16(22)18-15(14)7-9-17-19(3,12-21)10-5-11-20(17,18)4/h6,8,12-13,17,22H,5,7,9-11H2,1-4H3/t17-,19+,20-/m0/s1 |
| InChIKey | RIRYTDSIVDSPCY-SXLOBPIMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podocarpus latifolius (ncbitaxon:120620) | root (BTO:0001188) | PubMed (21306129) | Previous component: root bark; CH2Cl2-MeOH(1:1) extract of dried, ground root bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inumakal (CHEBI:68291) has role metabolite (CHEBI:25212) |
| inumakal (CHEBI:68291) is a abietane diterpenoid (CHEBI:36762) |
| inumakal (CHEBI:68291) is a aldehyde (CHEBI:17478) |
| inumakal (CHEBI:68291) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 11-hydroxy-14-(propan-2-yl)podocarpa-8,11,13-trien-16-al |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21394581 | Reaxys |
| Citations |
|---|