EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O |
| Net Charge | 0 |
| Average Mass | 284.443 |
| Monoisotopic Mass | 284.21402 |
| SMILES | [H][C@@]12CCc3c(C(C)C)ccc4c3[C@]1(CCCC2(C)C)CO4 |
| InChI | InChI=1S/C20H28O/c1-13(2)14-6-8-16-18-15(14)7-9-17-19(3,4)10-5-11-20(17,18)12-21-16/h6,8,13,17H,5,7,9-12H2,1-4H3/t17-,20+/m0/s1 |
| InChIKey | XNNWEJWWBGSSMR-FXAWDEMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podocarpus latifolius (ncbitaxon:120620) | root (BTO:0001188) | PubMed (21306129) | Previous component: root bark; CH2Cl2-MeOH(1:1) extract of dried, ground root bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cycloinumakiol (CHEBI:68290) has role metabolite (CHEBI:25212) |
| cycloinumakiol (CHEBI:68290) is a abietane diterpenoid (CHEBI:36762) |
| cycloinumakiol (CHEBI:68290) is a cyclic ether (CHEBI:37407) |
| cycloinumakiol (CHEBI:68290) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 14-(propan-2-yl)-11,17-epoxypodocarpa-8,11,13-triene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21394579 | Reaxys |
| Citations |
|---|