EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | C[C@H]1Oc2cccc(O)c2C(=O)[C@@H]1O |
| InChI | InChI=1S/C10H10O4/c1-5-9(12)10(13)8-6(11)3-2-4-7(8)14-5/h2-5,9,11-12H,1H3/t5-,9-/m1/s1 |
| InChIKey | COBAEYCUCRUGRP-MLUIRONXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microdiplodia (ncbitaxon:371130) | - | PubMed (21244021) | EtOAc extract of an endophytic fungi isolated from Lycium intricatum Strain: 9907 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-gynuraone (CHEBI:68289) has role antibacterial agent (CHEBI:33282) |
| (−)-gynuraone (CHEBI:68289) has role fungal metabolite (CHEBI:76946) |
| (−)-gynuraone (CHEBI:68289) is a chromanone (CHEBI:38763) |
| (−)-gynuraone (CHEBI:68289) is a phenols (CHEBI:33853) |
| (−)-gynuraone (CHEBI:68289) is a secondary alcohol (CHEBI:35681) |
| (−)-gynuraone (CHEBI:68289) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,3R)-3,5-dihydroxy-2-methyl-2,3-dihydro-4H-chromen-4-one |
| Citations |
|---|