EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O7 |
| Net Charge | 0 |
| Average Mass | 320.297 |
| Monoisotopic Mass | 320.08960 |
| SMILES | COC1=CC(=O)[C@@H](O)[C@@]2(O)C(=O)c3c(O)cc(C)cc3O[C@]12C |
| InChI | InChI=1S/C16H16O7/c1-7-4-8(17)12-10(5-7)23-15(2)11(22-3)6-9(18)13(19)16(15,21)14(12)20/h4-6,13,17,19,21H,1-3H3/t13-,15-,16-/m1/s1 |
| InChIKey | SIUXYUWNLUKHJD-FVQBIDKESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microdiplodia (ncbitaxon:371130) | - | PubMed (21244021) | EtOAc extract of an endophytic fungi isolated from Lycium intricatum Strain: 9907 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-microdiplodiasolol (CHEBI:68285) has role antibacterial agent (CHEBI:33282) |
| (−)-microdiplodiasolol (CHEBI:68285) has role fungal metabolite (CHEBI:76946) |
| (−)-microdiplodiasolol (CHEBI:68285) is a enol ether (CHEBI:47985) |
| (−)-microdiplodiasolol (CHEBI:68285) is a phenols (CHEBI:33853) |
| (−)-microdiplodiasolol (CHEBI:68285) is a secondary α-hydroxy ketone (CHEBI:2468) |
| (−)-microdiplodiasolol (CHEBI:68285) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| (−)-microdiplodiasolol (CHEBI:68285) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S,4aS,9aS)-1,8,9a-trihydroxy-4-methoxy-4a,6-dimethyl-4a,9a-dihydro-1H-xanthene-2,9-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21389528 | Reaxys |
| Citations |
|---|