EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O7 |
| Net Charge | 0 |
| Average Mass | 310.302 |
| Monoisotopic Mass | 310.10525 |
| SMILES | C[C@@]12Oc3cc(CO)cc(O)c3C(=O)[C@@]1(O)[C@@H](O)CC[C@@H]2O |
| InChI | InChI=1S/C15H18O7/c1-14-10(18)2-3-11(19)15(14,21)13(20)12-8(17)4-7(6-16)5-9(12)22-14/h4-5,10-11,16-19,21H,2-3,6H2,1H3/t10-,11-,14-,15-/m0/s1 |
| InChIKey | SCOQIJBVVKZZHE-GVARAGBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microdiplodia (ncbitaxon:371130) | - | PubMed (21244021) | EtOAc extract of an endophytic fungi isolated from Lycium intricatum Strain: 9907 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| microdiplodiasol (CHEBI:68283) has role antibacterial agent (CHEBI:33282) |
| microdiplodiasol (CHEBI:68283) has role metabolite (CHEBI:25212) |
| microdiplodiasol (CHEBI:68283) is a benzyl alcohols (CHEBI:22743) |
| microdiplodiasol (CHEBI:68283) is a phenols (CHEBI:33853) |
| microdiplodiasol (CHEBI:68283) is a secondary alcohol (CHEBI:35681) |
| microdiplodiasol (CHEBI:68283) is a tertiary alcohol (CHEBI:26878) |
| microdiplodiasol (CHEBI:68283) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| microdiplodiasol (CHEBI:68283) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S*,4S*,4aS*,9aR*)-1,4,8,9a-tetrahydroxy-6-(hydroxymethyl)-4a-methyl-1,2,3,4,4a,9a-hexahydro-9H-xanthen-9-one |
| Citations |
|---|