EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O6 |
| Net Charge | 0 |
| Average Mass | 294.303 |
| Monoisotopic Mass | 294.11034 |
| SMILES | Cc1cc(O)c2c(c1)O[C@@]1(C)[C@@H](O)CC[C@H](O)[C@]1(O)C2=O |
| InChI | InChI=1S/C15H18O6/c1-7-5-8(16)12-9(6-7)21-14(2)10(17)3-4-11(18)15(14,20)13(12)19/h5-6,10-11,16-18,20H,3-4H2,1-2H3/t10-,11-,14-,15-/m0/s1 |
| InChIKey | GBAMGKOMMOEKIB-GVARAGBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microdiplodia (ncbitaxon:371130) | - | PubMed (21244021) | EtOAc extract of an endophytic fungi isolated from Lycium intricatum Strain: 9907 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-diversonol (CHEBI:68282) has role antibacterial agent (CHEBI:33282) |
| (+)-diversonol (CHEBI:68282) has role metabolite (CHEBI:25212) |
| (+)-diversonol (CHEBI:68282) is a phenols (CHEBI:33853) |
| (+)-diversonol (CHEBI:68282) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,4S,4aS,9aR)-1,4,8,9a-tetrahydroxy-4a,6-dimethyl-1,2,3,4,4a,9a-hexahydro-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1325018 | Reaxys |
| Citations |
|---|