EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H43BrN4O7 |
| Net Charge | 0 |
| Average Mass | 723.665 |
| Monoisotopic Mass | 722.23151 |
| SMILES | C/C1=C\[C@H](C)C[C@H](C)OC(=O)/C=C(/c2ccc(O)c(O)c2)NC(=O)[C@@H](Cc2c(Br)nc3ccccc23)N(C)C(=O)[C@H](C)NC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C36H43BrN4O7/c1-19-13-20(2)15-22(4)48-32(44)18-28(24-11-12-30(42)31(43)16-24)40-35(46)29(17-26-25-9-7-8-10-27(25)39-33(26)37)41(6)36(47)23(5)38-34(45)21(3)14-19/h7-13,16,18,20-23,29,39,42-43H,14-15,17H2,1-6H3,(H,38,45)(H,40,46)/b19-13+,28-18-/t20-,21-,22-,23-,29+/m0/s1 |
| InChIKey | QIXWTNQUYUZIHF-HOYRBNAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | - | PubMed (21241058) | Methanolic extract of sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-jasplakinolide W (CHEBI:68279) has role animal metabolite (CHEBI:75767) |
| (+)-jasplakinolide W (CHEBI:68279) has role antineoplastic agent (CHEBI:35610) |
| (+)-jasplakinolide W (CHEBI:68279) has role marine metabolite (CHEBI:76507) |
| (+)-jasplakinolide W (CHEBI:68279) is a catechols (CHEBI:33566) |
| (+)-jasplakinolide W (CHEBI:68279) is a cyclodepsipeptide (CHEBI:35213) |
| (+)-jasplakinolide W (CHEBI:68279) is a indoles (CHEBI:24828) |
| (+)-jasplakinolide W (CHEBI:68279) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (3Z,7R,10S,13S,15E,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-4-(3,4-dihydroxyphenyl)-8,10,13,15,17,19-hexamethyl-1-oxa-5,8,11-triazacyclononadeca-3,15-diene-2,6,9,12-tetrone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21404712 | Reaxys |
| Citations |
|---|