EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H47BrN4O7 |
| Net Charge | 0 |
| Average Mass | 727.697 |
| Monoisotopic Mass | 726.26281 |
| SMILES | C/C(=C\[C@H](C)C[C@H](C)O)C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc1c(Br)nc2ccccc12)C(=O)N[C@H](CC(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C36H47BrN4O7/c1-20(15-21(2)17-23(4)42)16-22(3)34(46)38-24(5)36(48)41(6)31(18-28-27-9-7-8-10-29(27)39-33(28)37)35(47)40-30(19-32(44)45)25-11-13-26(43)14-12-25/h7-15,21-24,30-31,39,42-43H,16-19H2,1-6H3,(H,38,46)(H,40,47)(H,44,45)/b20-15+/t21-,22-,23-,24-,30+,31+/m0/s1 |
| InChIKey | PPXQSUWEWPAOGM-DHKPLNAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | - | PubMed (21241058) | Methanolic extract of sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-jasplakinolide Z1 (CHEBI:68274) has role animal metabolite (CHEBI:75767) |
| (+)-jasplakinolide Z1 (CHEBI:68274) has role antineoplastic agent (CHEBI:35610) |
| (+)-jasplakinolide Z1 (CHEBI:68274) has role marine metabolite (CHEBI:76507) |
| (+)-jasplakinolide Z1 (CHEBI:68274) is a depsipeptide (CHEBI:23643) |
| (+)-jasplakinolide Z1 (CHEBI:68274) is a indoles (CHEBI:24828) |
| (+)-jasplakinolide Z1 (CHEBI:68274) is a organobromine compound (CHEBI:37141) |
| (+)-jasplakinolide Z1 (CHEBI:68274) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-[(2S,4E,6R,8S)-8-hydroxy-2,4,6-trimethylnon-4-enoyl]-L-alanyl-2-bromo-N-[(1R)-2-carboxy-1-(4-hydroxyphenyl)ethyl]-Nα-methyl-D-tryptophanamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21404708 | Reaxys |
| Citations |
|---|