EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H44Br2N4O6 |
| Net Charge | 0 |
| Average Mass | 788.578 |
| Monoisotopic Mass | 786.16276 |
| SMILES | C/C1=C\[C@H](C)C[C@H](C)OC(=O)C[C@H](c2ccc(O)cc2)NC(=O)[C@@H](Cc2c(Br)nc3cc(Br)ccc23)N(C)C(=O)[C@H](C)NC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C36H44Br2N4O6/c1-19-13-20(2)15-22(4)48-32(44)18-29(24-7-10-26(43)11-8-24)41-35(46)31(42(6)36(47)23(5)39-34(45)21(3)14-19)17-28-27-12-9-25(37)16-30(27)40-33(28)38/h7-13,16,20-23,29,31,40,43H,14-15,17-18H2,1-6H3,(H,39,45)(H,41,46)/b19-13+/t20-,21-,22-,23-,29+,31+/m0/s1 |
| InChIKey | DECYMRKFVIEIJT-DCKISPQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | - | PubMed (21241058) | Methanolic extract of sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jasplakinolide R1 (CHEBI:68273) has role animal metabolite (CHEBI:75767) |
| jasplakinolide R1 (CHEBI:68273) has role antineoplastic agent (CHEBI:35610) |
| jasplakinolide R1 (CHEBI:68273) has role marine metabolite (CHEBI:76507) |
| jasplakinolide R1 (CHEBI:68273) is a cyclodepsipeptide (CHEBI:35213) |
| jasplakinolide R1 (CHEBI:68273) is a indoles (CHEBI:24828) |
| jasplakinolide R1 (CHEBI:68273) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,15E,17R,19S)-7-[(2,6-dibromo-1H-indol-3-yl)methyl]-4-(4-hydroxyphenyl)-8,10,13,15,17,19-hexamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21404711 | Reaxys |
| Citations |
|---|