EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46N4O6 |
| Net Charge | 0 |
| Average Mass | 630.786 |
| Monoisotopic Mass | 630.34174 |
| SMILES | C/C1=C\[C@H](C)C[C@H](C)OC(=O)C[C@H](c2ccc(O)cc2)NC(=O)[C@@H](Cc2cnc3ccccc23)N(C)C(=O)[C@H](C)NC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C36H46N4O6/c1-21-15-22(2)17-24(4)46-33(42)19-31(26-11-13-28(41)14-12-26)39-35(44)32(18-27-20-37-30-10-8-7-9-29(27)30)40(6)36(45)25(5)38-34(43)23(3)16-21/h7-15,20,22-25,31-32,37,41H,16-19H2,1-6H3,(H,38,43)(H,39,44)/b21-15+/t22-,23-,24-,25-,31+,32+/m0/s1 |
| InChIKey | PWHMXYJBGYEDHW-RWGHOPJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | - | PubMed (21241058) | Methanolic extract of sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jasplakinolide Q (CHEBI:68272) has role animal metabolite (CHEBI:75767) |
| jasplakinolide Q (CHEBI:68272) has role antineoplastic agent (CHEBI:35610) |
| jasplakinolide Q (CHEBI:68272) has role marine metabolite (CHEBI:76507) |
| jasplakinolide Q (CHEBI:68272) is a cyclodepsipeptide (CHEBI:35213) |
| jasplakinolide Q (CHEBI:68272) is a indoles (CHEBI:24828) |
| jasplakinolide Q (CHEBI:68272) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,15E,17R,19S)-4-(4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-8,10,13,15,17,19-hexamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19477210 | Reaxys |
| Citations |
|---|