EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O6 |
| Net Charge | 0 |
| Average Mass | 390.476 |
| Monoisotopic Mass | 390.20424 |
| SMILES | COCC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C22H30O6/c1-22(2,16-4-8-20(9-5-16)27-14-18(24)12-23)17-6-10-21(11-7-17)28-15-19(25)13-26-3/h4-11,18-19,23-25H,12-15H2,1-3H3 |
| InChIKey | GCLSCNOGXASPBH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-(2-(4-(2-hydroxy-3-methoxypropoxy)phenyl)propan-2-yl)phenoxy)propane-1,2-diol (CHEBI:68269) has role metabolite (CHEBI:25212) |
| 3-(4-(2-(4-(2-hydroxy-3-methoxypropoxy)phenyl)propan-2-yl)phenoxy)propane-1,2-diol (CHEBI:68269) is a diarylmethane (CHEBI:51614) |
| Citations |
|---|