EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O4 |
| Net Charge | 0 |
| Average Mass | 304.386 |
| Monoisotopic Mass | 304.16746 |
| SMILES | [H][C@@]12C[C@@]3([H])C(=C)C[C@]1(C=CC(=O)[C@@]2(C)CCC(=O)OC)C[C@@H]3O |
| InChI | InChI=1S/C18H24O4/c1-11-9-18-7-4-15(20)17(2,6-5-16(21)22-3)14(18)8-12(11)13(19)10-18/h4,7,12-14,19H,1,5-6,8-10H2,2-3H3/t12-,13-,14-,17-,18+/m0/s1 |
| InChIKey | YNZQBHPCQCEONI-TZUPDSNESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-hydroxyplatencinic acid methyl ester (CHEBI:68268) has role metabolite (CHEBI:25212) |
| 12-hydroxyplatencinic acid methyl ester (CHEBI:68268) is a fatty acid ester (CHEBI:35748) |
| Citations |
|---|