EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@]12CC[C@@]3(C=CC(=O)[C@@](C)(CCC(=O)OCC(O)CO)[C@]3([H])C1)CC2=C |
| InChI | InChI=1S/C20H28O5/c1-13-10-20-7-3-14(13)9-16(20)19(2,17(23)4-8-20)6-5-18(24)25-12-15(22)11-21/h4,8,14-16,21-22H,1,3,5-7,9-12H2,2H3/t14-,15?,16-,19-,20+/m0/s1 |
| InChIKey | FYKIZBPSTADBEK-HEXGFAOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Platencinic acid glycerol ester (CHEBI:68267) has role metabolite (CHEBI:25212) |
| Platencinic acid glycerol ester (CHEBI:68267) is a 1-monoglyceride (CHEBI:35759) |
| Citations |
|---|