EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31NO8 |
| Net Charge | 0 |
| Average Mass | 473.522 |
| Monoisotopic Mass | 473.20497 |
| SMILES | [H][C@]12CC[C@@]3(C=CC(=O)[C@@](C)(CCC(=O)Nc4c(O)ccc(C(=O)OC)c4O)[C@]3([H])C1)C[C@]2(O)CO |
| InChI | InChI=1S/C25H31NO8/c1-23(8-7-19(30)26-20-16(28)4-3-15(21(20)31)22(32)34-2)17-11-14-5-9-24(17,10-6-18(23)29)12-25(14,33)13-27/h3-4,6,10,14,17,27-28,31,33H,5,7-9,11-13H2,1-2H3,(H,26,30)/t14-,17-,23-,24+,25-/m0/s1 |
| InChIKey | UQTMBBQISVQTGO-BXNMXXHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Platencin A11 methyl ester (CHEBI:68266) has role metabolite (CHEBI:25212) |
| Platencin A11 methyl ester (CHEBI:68266) is a aromatic amine (CHEBI:33860) |
| Citations |
|---|