EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O4 |
| Net Charge | 0 |
| Average Mass | 304.386 |
| Monoisotopic Mass | 304.16746 |
| SMILES | [H][C@]12C[C@@H](O)[C@@]3(C=CC(=O)[C@@](C)(CCC(=O)OC)[C@]3([H])C1)CC2=C |
| InChI | InChI=1S/C18H24O4/c1-11-10-18-7-4-14(19)17(2,6-5-16(21)22-3)13(18)8-12(11)9-15(18)20/h4,7,12-13,15,20H,1,5-6,8-10H2,2-3H3/t12-,13+,15-,17+,18+/m1/s1 |
| InChIKey | SFPJDANZIPLSTD-ASZYTAPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-hydroxyplatencinic acid methyl ester (CHEBI:68260) has role metabolite (CHEBI:25212) |
| 13-hydroxyplatencinic acid methyl ester (CHEBI:68260) is a cyclic ketone (CHEBI:3992) |
| 13-hydroxyplatencinic acid methyl ester (CHEBI:68260) is a methyl ester (CHEBI:25248) |
| 13-hydroxyplatencinic acid methyl ester (CHEBI:68260) is a polycyclic cage (CHEBI:33640) |
| 13-hydroxyplatencinic acid methyl ester (CHEBI:68260) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| methyl 3-[(2R,4aR,8S,8aR,9R)-9-hydroxy-8-methyl-3-methylidene-7-oxo-1,3,4,7,8,8a-hexahydro-2H-2,4a-ethanonaphthalen-8-yl]propanoate |
| Citations |
|---|