EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N4.C9H9NO3 |
| Net Charge | 0 |
| Average Mass | 319.365 |
| Monoisotopic Mass | 319.16444 |
| SMILES | C1N2CN3CN1CN(C2)C3.O=C(O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H9NO3.C6H12N4/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;1-7-2-9-4-8(1)5-10(3-7)6-9/h1-5H,6H2,(H,10,13)(H,11,12);1-6H2 |
| InChIKey | ROAIXOJGRFKICW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methenamine hippurate (CHEBI:6825) has functional parent N-benzoylglycine (CHEBI:18089) |
| Methenamine hippurate (CHEBI:6825) is a N-acylglycine (CHEBI:16180) |
| Synonym | Source |
|---|---|
| Methenamine hippurate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D00855 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:5714-73-8 | KEGG COMPOUND |