EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N2O6 |
| Net Charge | 0 |
| Average Mass | 458.555 |
| Monoisotopic Mass | 458.24169 |
| SMILES | [H][C@]12C[C@]34C=CC(=O)[C@@](C)(CC/C=C(\C)C(=O)N[C@@H](CCC(N)=O)C(=O)O)[C@]3([H])[C@]([H])(C1)O[C@@]2(C)C4 |
| InChI | InChI=1S/C25H34N2O6/c1-14(21(30)27-16(22(31)32)6-7-19(26)29)5-4-9-23(2)18(28)8-10-25-12-15-11-17(20(23)25)33-24(15,3)13-25/h5,8,10,15-17,20H,4,6-7,9,11-13H2,1-3H3,(H2,26,29)(H,27,30)(H,31,32)/b14-5+/t15-,16+,17+,20+,23-,24+,25+/m1/s1 |
| InChIKey | LSLTZMQPHAAWAW-XJYCCHPDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homoplatensimide A (CHEBI:68247) has role bacterial metabolite (CHEBI:76969) |
| homoplatensimide A (CHEBI:68247) is a cyclic ether (CHEBI:37407) |
| homoplatensimide A (CHEBI:68247) is a cyclic ketone (CHEBI:3992) |
| homoplatensimide A (CHEBI:68247) is a dicarboxylic acid monoamide (CHEBI:35735) |
| homoplatensimide A (CHEBI:68247) is a monocarboxylic acid (CHEBI:25384) |
| homoplatensimide A (CHEBI:68247) is a polycyclic cage (CHEBI:33640) |
| Incoming Relation(s) |
| homoplatensimide A methyl ester (CHEBI:68248) has functional parent homoplatensimide A (CHEBI:68247) |
| IUPAC Name |
|---|
| N2-{(2E)-5-[(1S,4aS,6S,7S,9S,9aR)-1,6-dimethyl-2-oxo-1,2,5,6,7,8,9,9a-octahydro-6,9-epoxy-4a,7-methanobenzo[7]annulen-1-yl]-2-methylpent-2-enoyl}-L-glutamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15845102 | Reaxys |
| Citations |
|---|