EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N2O6 |
| Net Charge | 0 |
| Average Mass | 432.517 |
| Monoisotopic Mass | 432.22604 |
| SMILES | [H][C@]12C[C@]34C=CC(=O)[C@@](C)(CCC(=O)N[C@@H](CCNC(C)=O)C(=O)O)[C@]3([H])[C@]([H])(C1)O[C@@]2(C)C4 |
| InChI | InChI=1S/C23H32N2O6/c1-13(26)24-9-6-15(20(29)30)25-18(28)5-7-21(2)17(27)4-8-23-11-14-10-16(19(21)23)31-22(14,3)12-23/h4,8,14-16,19H,5-7,9-12H2,1-3H3,(H,24,26)(H,25,28)(H,29,30)/t14-,15+,16+,19+,21-,22+,23+/m1/s1 |
| InChIKey | DFUHBSQGPGWPQE-UBSGIXRYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platensimide A (CHEBI:68246) has role metabolite (CHEBI:25212) |
| platensimide A (CHEBI:68246) is a acetamides (CHEBI:22160) |
| platensimide A (CHEBI:68246) is a cyclic ether (CHEBI:37407) |
| platensimide A (CHEBI:68246) is a cyclic ketone (CHEBI:3992) |
| platensimide A (CHEBI:68246) is a monocarboxylic acid (CHEBI:25384) |
| platensimide A (CHEBI:68246) is a polycyclic cage (CHEBI:33640) |
| IUPAC Name |
|---|
| (2S)-4-(acetylamino)-2-({3-[(1S,4aS,6S,7S,9S,9aR)-1,6-dimethyl-2-oxo-1,2,5,6,7,8,9,9a-octahydro-6,9-epoxy-4a,7-methanobenzo[7]annulen-1-yl]propanoyl}amino)butanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19006912 | Reaxys |
| Citations |
|---|