EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O7 |
| Net Charge | 0 |
| Average Mass | 190.107 |
| Monoisotopic Mass | 190.01135 |
| SMILES | [H][C@]1(C(=O)O)OC(=O)C[C@@]1(O)C(=O)O |
| InChI | InChI=1S/C6H6O7/c7-2-1-6(12,5(10)11)3(13-2)4(8)9/h3,12H,1H2,(H,8,9)(H,10,11)/t3-,6+/m1/s1 |
| InChIKey | PFHZIWAVXDSFTB-CVYQJGLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia cambogia (IPNI:427866-1) | exocarp (BTO:0000733) | PubMed (21114277) | Fresh dried rind of the fruit |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-garcinia acid (CHEBI:68235) has role metabolite (CHEBI:25212) |
| (+)-garcinia acid (CHEBI:68235) is a butan-4-olide (CHEBI:22950) |
| (+)-garcinia acid (CHEBI:68235) is a hydroxy carboxylic acid (CHEBI:24669) |
| Synonym | Source |
|---|---|
| (+)-(2S,3S)-tetrahydro-3-hydroxy-5-oxo-2,3-furandicarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:86611 | Reaxys |
| Citations |
|---|