EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O3 |
| Net Charge | 0 |
| Average Mass | 192.214 |
| Monoisotopic Mass | 192.07864 |
| SMILES | C=CCc1cc(OC)c2c(c1)OCO2 |
| InChI | InChI=1S/C11H12O3/c1-3-4-8-5-9(12-2)11-10(6-8)13-7-14-11/h3,5-6H,1,4,7H2,2H3 |
| InChIKey | BNWJOHGLIBDBOB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myristica fragrans (ncbitaxon:51089) | fruit (BTO:0000486) | PubMed (20879744) | |
| Ligusticum porteri (ncbitaxon:54719) | root (BTO:0001188) | PubMed (20879744) | Air-dried and pulverized roots were macerated with CH2Cl2-MeOH(1:1) |
| Petroselinum crispum (ncbitaxon:4043) | seed (BTO:0001226) | PubMed (21049975) | Essential oil of seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myristicin (CHEBI:68234) has role metabolite (CHEBI:25212) |
| myristicin (CHEBI:68234) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Myristicin | KEGG COMPOUND |
| Benzene, 5-allyl-1-methoxy-2,3-(methylenedioxy)- | ChEBI |
| 6-Allyl-4-methoxy-1,3-benzodioxole | ChEBI |
| 1,3-Benzodioxole, 4-methoxy-6-(2-propenyl)- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10480 | KEGG COMPOUND |
| C00002762 | KNApSAcK |
| HMDB0035873 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:607-91-0 | KEGG COMPOUND |
| CAS:607-91-0 | ChemIDplus |
| Citations |
|---|