EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O2 |
| Net Charge | 0 |
| Average Mass | 188.226 |
| Monoisotopic Mass | 188.08373 |
| SMILES | CCC/C=C1\OC(=O)c2ccccc21 |
| InChI | InChI=1S/C12H12O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h4-8H,2-3H2,1H3/b11-8- |
| InChIKey | WMBOCUXXNSOQHM-FLIBITNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ligusticum porteri (ncbitaxon:54719) | root (BTO:0001188) | PubMed (20879744) | Air-dried and pulverized roots were macerated with CH2Cl2-MeOH(1:1) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-3-butylidenephthalide (CHEBI:68233) has functional parent 2-benzofuran-1(3H)-one (CHEBI:38085) |
| (Z)-3-butylidenephthalide (CHEBI:68233) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| (Z)-3-butylidenephthalide (CHEBI:68233) has role hypoglycemic agent (CHEBI:35526) |
| (Z)-3-butylidenephthalide (CHEBI:68233) has role metabolite (CHEBI:25212) |
| (Z)-3-butylidenephthalide (CHEBI:68233) is a 2-benzofurans (CHEBI:38831) |
| (Z)-3-butylidenephthalide (CHEBI:68233) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3Z)-3-butylidene-2-benzofuran-1(3H)-one |
| Synonym | Source |
|---|---|
| Butylidenephthalide | KEGG COMPOUND |
| Citations |
|---|