EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O2 |
| Net Charge | 0 |
| Average Mass | 190.242 |
| Monoisotopic Mass | 190.09938 |
| SMILES | CCC/C=C1\OC(=O)C2=C1CCC=C2 |
| InChI | InChI=1S/C12H14O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7-8H,2-4,6H2,1H3/b11-8- |
| InChIKey | IQVQXVFMNOFTMU-FLIBITNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ligusticum porteri (ncbitaxon:54719) | root (BTO:0001188) | PubMed (20879744) | Air-dried and pulverized roots were macerated with CH2Cl2-MeOH(1:1) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-ligustilide (CHEBI:68232) has role metabolite (CHEBI:25212) |
| (Z)-ligustilide (CHEBI:68232) is a butenolide (CHEBI:50523) |
| Synonym | Source |
|---|---|
| 1(3H)-Isobenzofuranone, 3-butylidene-4,5-dihydro- | ChEBI |
| Citations |
|---|