EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N3O2 |
| Net Charge | 0 |
| Average Mass | 333.391 |
| Monoisotopic Mass | 333.14773 |
| SMILES | O=C1N[C@@H](Cc2cnc3ccccc23)C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c24-19-17(10-13-6-2-1-3-7-13)22-20(25)18(23-19)11-14-12-21-16-9-5-4-8-15(14)16/h1-9,12,17-18,21H,10-11H2,(H,22,25)(H,23,24)/t17-,18-/m0/s1 |
| InChIKey | CUVKAUWOMPJEMI-ROUUACIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (11S,14S)-Cyclo-(L-Trp-L-Phe) (CHEBI:68230) has role Aspergillus metabolite (CHEBI:76956) |
| (11S,14S)-Cyclo-(L-Trp-L-Phe) (CHEBI:68230) is a indoles (CHEBI:24828) |
| Synonym | Source |
|---|---|
| (3S,6S)-3-Benzyl-6-(1H-indol-3-ylmethyl)-2,5-piperazinedione | ChEBI |
| Citations |
|---|