EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2S |
| Net Charge | 0 |
| Average Mass | 296.439 |
| Monoisotopic Mass | 296.13472 |
| SMILES | CN1CCC(CN2c3ccccc3Sc3ccccc32)C1 |
| InChI | InChI=1S/C18H20N2S/c1-19-11-10-14(12-19)13-20-15-6-2-4-8-17(15)21-18-9-5-3-7-16(18)20/h2-9,14H,10-13H2,1H3 |
| InChIKey | HTMIBDQKFHUPSX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methdilazine (CHEBI:6823) has role antipruritic drug (CHEBI:59683) |
| methdilazine (CHEBI:6823) has role cholinergic antagonist (CHEBI:48873) |
| methdilazine (CHEBI:6823) has role histamine antagonist (CHEBI:37956) |
| methdilazine (CHEBI:6823) is a N-alkylpyrrolidine (CHEBI:46775) |
| methdilazine (CHEBI:6823) is a phenothiazines (CHEBI:38093) |
| Incoming Relation(s) |
| methdilazine hydrochloride (CHEBI:140855) has part methdilazine (CHEBI:6823) |
| IUPAC Name |
|---|
| 10-[(1-methylpyrrolidin-3-yl)methyl]-10H-phenothiazine |
| INNs | Source |
|---|---|
| metdilazina | WHO MedNet |
| methdilazine | KEGG DRUG |
| methdilazine | WHO MedNet |
| methdilazinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 10-[(1-methyl-3-pyrrolidinyl)methyl]phenothiazine | ChEBI |
| Methdilazine | KEGG COMPOUND |
| MJ 5022 | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Dilosyn | DrugBank |
| Tacaryl | KEGG DRUG |
| Tacazyl | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 1742 | DrugCentral |
| C07175 | KEGG COMPOUND |
| D04979 | KEGG DRUG |
| DB00902 | DrugBank |
| HMDB0015038 | HMDB |
| Methdilazine | Wikipedia |
| Citations |
|---|