EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COC(=O)c1cccc2oc3cc(C)cc(O)c3c(=O)c12 |
| InChI | InChI=1S/C16H12O5/c1-8-6-10(17)14-12(7-8)21-11-5-3-4-9(16(19)20-2)13(11)15(14)18/h3-7,17H,1-2H3 |
| InChIKey | YEKIIDIQOZQXAX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 8-hydroxy-6-methyl-9-oxo-9H-xanthene-1-carboxylate (CHEBI:68226) has role Aspergillus metabolite (CHEBI:76956) |
| methyl 8-hydroxy-6-methyl-9-oxo-9H-xanthene-1-carboxylate (CHEBI:68226) is a aromatic ester (CHEBI:62732) |
| methyl 8-hydroxy-6-methyl-9-oxo-9H-xanthene-1-carboxylate (CHEBI:68226) is a phenols (CHEBI:33853) |
| methyl 8-hydroxy-6-methyl-9-oxo-9H-xanthene-1-carboxylate (CHEBI:68226) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| methyl 8-hydroxy-6-methyl-9-oxo-9H-xanthene-1-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6870943 | Reaxys |
| Citations |
|---|