EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COC(=O)[C@@H]1c2c(oc3cc(CO)cc(O)c3c2=O)C=C[C@H]1O |
| InChI | InChI=1S/C16H14O7/c1-22-16(21)13-8(18)2-3-10-14(13)15(20)12-9(19)4-7(6-17)5-11(12)23-10/h2-5,8,13,17-19H,6H2,1H3/t8-,13+/m1/s1 |
| InChIKey | MPAKYMOQGZITTQ-OQPBUACISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7R,8R)-AGI-B4 (CHEBI:68224) has role Aspergillus metabolite (CHEBI:76956) |
| (7R,8R)-AGI-B4 (CHEBI:68224) has role antioxidant (CHEBI:22586) |
| (7R,8R)-AGI-B4 (CHEBI:68224) is a aromatic primary alcohol (CHEBI:33857) |
| (7R,8R)-AGI-B4 (CHEBI:68224) is a methyl ester (CHEBI:25248) |
| (7R,8R)-AGI-B4 (CHEBI:68224) is a phenols (CHEBI:33853) |
| (7R,8R)-AGI-B4 (CHEBI:68224) is a secondary alcohol (CHEBI:35681) |
| (7R,8R)-AGI-B4 (CHEBI:68224) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| methyl (1R,2R)-2,8-dihydroxy-6-(hydroxymethyl)-9-oxo-2,9-dihydro-1H-xanthene-1-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21708358 | Reaxys |
| Citations |
|---|