EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O4 |
| Net Charge | 0 |
| Average Mass | 266.337 |
| Monoisotopic Mass | 266.15181 |
| SMILES | CC(C)CCC[C@](C)(O)c1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C15H22O4/c1-10(2)5-4-8-15(3,19)12-7-6-11(14(17)18)9-13(12)16/h6-7,9-10,16,19H,4-5,8H2,1-3H3,(H,17,18)/t15-/m0/s1 |
| InChIKey | VZXPWVDKXCYHSI-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. (ncbitaxon:5065) | - | PubMed (21718031) | |
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(7S)-sydonic acid (CHEBI:68223) has role Aspergillus metabolite (CHEBI:76956) |
| (+)-(7S)-sydonic acid (CHEBI:68223) is a aromatic alcohol (CHEBI:33854) |
| (+)-(7S)-sydonic acid (CHEBI:68223) is a monohydroxybenzoic acid (CHEBI:25389) |
| (+)-(7S)-sydonic acid (CHEBI:68223) is a sesquiterpenoid (CHEBI:26658) |
| Incoming Relation(s) |
| (+)-(7S)-7-O-methylsydonic acid (CHEBI:68220) has functional parent (+)-(7S)-sydonic acid (CHEBI:68223) |
| IUPAC Name |
|---|
| 3-hydroxy-4-[(2S)-2-hydroxy-6-methylheptan-2-yl]benzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19158335 | Reaxys |
| Citations |
|---|