EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O8 |
| Net Charge | 0 |
| Average Mass | 336.296 |
| Monoisotopic Mass | 336.08452 |
| SMILES | COC(=O)[C@@]1(O)c2c(oc3cc(CO)cc(O)c3c2=O)CC[C@H]1O |
| InChI | InChI=1S/C16H16O8/c1-23-15(21)16(22)11(19)3-2-9-13(16)14(20)12-8(18)4-7(6-17)5-10(12)24-9/h4-5,11,17-19,22H,2-3,6H2,1H3/t11-,16+/m1/s1 |
| InChIKey | JYINNDQRROYTKO-BZNIZROVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspergillusone B (CHEBI:68222) has role Aspergillus metabolite (CHEBI:76956) |
| aspergillusone B (CHEBI:68222) is a aromatic primary alcohol (CHEBI:33857) |
| aspergillusone B (CHEBI:68222) is a methyl ester (CHEBI:25248) |
| aspergillusone B (CHEBI:68222) is a phenols (CHEBI:33853) |
| aspergillusone B (CHEBI:68222) is a secondary alcohol (CHEBI:35681) |
| aspergillusone B (CHEBI:68222) is a tertiary alcohol (CHEBI:26878) |
| aspergillusone B (CHEBI:68222) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| rel-methyl (1R,2R)-1,2,8-trihydroxy-6-(hydroxymethyl)-9-oxo-2,3,4,9-tetrahydro-1H-xanthene-1-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21708359 | Reaxys |
| Citations |
|---|