EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COC(=O)[C@@H]1c2c(oc3cc(C)cc(O)c3c2=O)C=C[C@H]1O |
| InChI | InChI=1S/C16H14O6/c1-7-5-9(18)12-11(6-7)22-10-4-3-8(17)13(16(20)21-2)14(10)15(12)19/h3-6,8,13,17-18H,1-2H3/t8-,13+/m1/s1 |
| InChIKey | LPMOHIIEWMTZSE-OQPBUACISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspergillusone A (CHEBI:68221) has role Aspergillus metabolite (CHEBI:76956) |
| aspergillusone A (CHEBI:68221) is a methyl ester (CHEBI:25248) |
| aspergillusone A (CHEBI:68221) is a phenols (CHEBI:33853) |
| aspergillusone A (CHEBI:68221) is a secondary alcohol (CHEBI:35681) |
| aspergillusone A (CHEBI:68221) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| rel-methyl (1R,2R)-2,8-dihydroxy-6-methyl-9-oxo-2,9-dihydro-1H-xanthene-1-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21708357 | Reaxys |
| Citations |
|---|