EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N4O3S2 |
| Net Charge | 0 |
| Average Mass | 236.278 |
| Monoisotopic Mass | 236.00378 |
| SMILES | CC(=O)/N=c1/sc(S(N)(=O)=O)nn1C |
| InChI | InChI=1S/C5H8N4O3S2/c1-3(10)7-4-9(2)8-5(13-4)14(6,11)12/h1-2H3,(H2,6,11,12)/b7-4+ |
| InChIKey | FLOSMHQXBMRNHR-QPJJXVBHSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methazolamide (CHEBI:6822) has role antiglaucoma drug (CHEBI:39456) |
| Methazolamide (CHEBI:6822) has role antineoplastic agent (CHEBI:35610) |
| Methazolamide (CHEBI:6822) is a sulfonamide (CHEBI:35358) |
| Methazolamide (CHEBI:6822) is a thiadiazoles (CHEBI:38099) |
| INN | Source |
|---|---|
| metazolamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-584601 | ChEMBL |
| Methazolamide | KEGG COMPOUND |
| NSC-758426 | ChEMBL |
| VVP-808 | ChEMBL |
| VVP808 | ChEMBL |
| Citations |
|---|