EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O3 |
| Net Charge | 0 |
| Average Mass | 246.306 |
| Monoisotopic Mass | 246.12559 |
| SMILES | Cc1c(CCC(C)C)oc2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C15H18O3/c1-9(2)4-7-13-10(3)12-6-5-11(15(16)17)8-14(12)18-13/h5-6,8-9H,4,7H2,1-3H3,(H,16,17) |
| InChIKey | PLDCIRZIXZQVGV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspergillusene B (CHEBI:68219) has role Aspergillus metabolite (CHEBI:76956) |
| aspergillusene B (CHEBI:68219) is a 1-benzofurans (CHEBI:38830) |
| aspergillusene B (CHEBI:68219) is a monocarboxylic acid (CHEBI:25384) |
| aspergillusene B (CHEBI:68219) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 3-methyl-2-(3-methylbutyl)-1-benzofuran-6-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21708355 | Reaxys |
| Citations |
|---|