EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | C/C(=C\CCC(C)C)c1ccc(CO)cc1O |
| InChI | InChI=1S/C15H22O2/c1-11(2)5-4-6-12(3)14-8-7-13(10-16)9-15(14)17/h6-9,11,16-17H,4-5,10H2,1-3H3/b12-6+ |
| InChIKey | NWPUHDAIOGMKFI-WUXMJOGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (21718031) | Ethyl acetate extract of culture broth, fungus isolated from a sea fan, Annella sp. Strain: PSU F154 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspergillusene A (CHEBI:68218) has role Aspergillus metabolite (CHEBI:76956) |
| aspergillusene A (CHEBI:68218) is a benzyl alcohols (CHEBI:22743) |
| aspergillusene A (CHEBI:68218) is a phenols (CHEBI:33853) |
| aspergillusene A (CHEBI:68218) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 5-(hydroxymethyl)-2-[(2E)-6-methylhept-2-en-2-yl]phenol |
| Synonym | Source |
|---|---|
| (E)-5-(hydroxymethyl)-2-(6'-methylhept-2'-en-2'-yl)phenol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21708354 | Reaxys |
| Citations |
|---|