EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H46O15 |
| Net Charge | 0 |
| Average Mass | 694.727 |
| Monoisotopic Mass | 694.28367 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)[C@]3(O)[C@@H](C)C(=O)O[C@@]3([H])[C@H](OC)C(=C)/C=C\[C@@H](OC(C)=O)[C@@]1(C)[C@@H](OC(=O)CC(C)C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@]21CO1 |
| InChI | InChI=1S/C34H46O15/c1-15(2)13-23(39)48-27-25(45-19(6)36)28(46-20(7)37)33(14-43-33)26-30(47-21(8)38)34(41)17(4)31(40)49-29(34)24(42-10)16(3)11-12-22(32(26,27)9)44-18(5)35/h11-12,15,17,22,24-30,41H,3,13-14H2,1-2,4-10H3/b12-11-/t17-,22?,24+,25+,26+,27-,28+,29-,30-,32+,33-,34-/m0/s1 |
| InChIKey | NPDWRKAPYWUGGC-KTEJYYAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dichotella gemmacea (ncbitaxon:767270) | - | PubMed (21721519) | Ethyl acetate soluble portion of combined extract of acetone and methanol of frozen specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gemmacolide M, (rel)- (CHEBI:68215) has role metabolite (CHEBI:25212) |
| Gemmacolide M, (rel)- (CHEBI:68215) is a fatty acid ester (CHEBI:35748) |
| Manual Xrefs | Databases |
|---|---|
| 27022370 | ChemSpider |
| Citations |
|---|