EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H43ClO15 |
| Net Charge | 0 |
| Average Mass | 715.145 |
| Monoisotopic Mass | 714.22905 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)[C@]3(O)[C@@H](C)C(=O)O[C@@]3([H])[C@@H](Cl)C(=C)/C=C\[C@H](OC(=O)CO)[C@@]1(C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(=O)CC(C)C)[C@]21CO1 |
| InChI | InChI=1S/C33H43ClO15/c1-14(2)11-21(39)48-28-24(44-17(5)36)27(45-18(6)37)31(8)20(47-22(40)12-35)10-9-15(3)23(34)26-33(42,16(4)30(41)49-26)29(46-19(7)38)25(31)32(28)13-43-32/h9-10,14,16,20,23-29,35,42H,3,11-13H2,1-2,4-8H3/b10-9-/t16-,20-,23-,24+,25+,26-,27-,28+,29-,31+,32-,33-/m0/s1 |
| InChIKey | JDAZPYNSXYPAGN-IGYAXIRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dichotella gemmacea (ncbitaxon:767270) | - | PubMed (21721519) | Ethyl acetate soluble portion of combined extract of acetone and methanol of frozen specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gemmacolide K, (rel)- (CHEBI:68213) has role metabolite (CHEBI:25212) |
| Gemmacolide K, (rel)- (CHEBI:68213) is a carbonyl compound (CHEBI:36586) |
| Citations |
|---|