EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35ClO12 |
| Net Charge | 0 |
| Average Mass | 599.029 |
| Monoisotopic Mass | 598.18170 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)[C@]3(O)[C@@H](C)C(=O)O[C@@]3([H])[C@@H](Cl)C(=C)/C=C/[C@H](OC(C)=O)[C@@]1(C)[C@@H](OC(C)=O)C[C@@H](OC(C)=O)[C@]21CO1 |
| InChI | InChI=1S/C28H35ClO12/c1-12-8-9-18(37-14(3)30)26(7)19(38-15(4)31)10-20(39-16(5)32)27(11-36-27)22(26)24(40-17(6)33)28(35)13(2)25(34)41-23(28)21(12)29/h8-9,13,18-24,35H,1,10-11H2,2-7H3/b9-8+/t13-,18-,19-,20+,21-,22+,23-,24-,26-,27+,28-/m0/s1 |
| InChIKey | SOPGXGVLWJRPKF-GBGQAHMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dichotella gemmacea (ncbitaxon:767270) | - | PubMed (21721519) | Ethyl acetate soluble portion of combined extract of acetone and methanol of frozen specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gemmacolide H, (rel)- (CHEBI:68210) has role metabolite (CHEBI:25212) |
| Gemmacolide H, (rel)- (CHEBI:68210) is a γ-lactone (CHEBI:37581) |
| Citations |
|---|