EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O |
| Net Charge | 0 |
| Average Mass | 250.301 |
| Monoisotopic Mass | 250.11061 |
| SMILES | Cc1ccccc1-n1c(C)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H14N2O/c1-11-7-3-6-10-15(11)18-12(2)17-14-9-5-4-8-13(14)16(18)19/h3-10H,1-2H3 |
| InChIKey | JEYCTXHKTXCGPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methaqualone (CHEBI:6821) has role GABA agonist (CHEBI:51373) |
| methaqualone (CHEBI:6821) has role sedative (CHEBI:35717) |
| methaqualone (CHEBI:6821) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| 2-methyl-3-(2-methylphenyl)quinazolin-4(3H)-one |
| INNs | Source |
|---|---|
| metacualona | ChemIDplus |
| methaqualone | ChemIDplus |
| methaqualonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| CI-705 | ChEMBL |
| CN 38703 | ChEMBL |
| CN-38703 | ChEMBL |
| NSC-111388 | ChEMBL |
| NSC-111388- | ChEMBL |
| NSC-126877 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:72-44-6 | ChemIDplus |
| Citations |
|---|