EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14N2O5S |
| Net Charge | 0 |
| Average Mass | 382.397 |
| Monoisotopic Mass | 382.06234 |
| SMILES | [C-]#[N+]C(=C\c1ccc(OC)cc1)/C(=C/c1ccc(OS(=O)(=O)O)cc1)[N+]#[C-] |
| InChI | InChI=1S/C19H14N2O5S/c1-20-18(12-14-4-8-16(25-3)9-5-14)19(21-2)13-15-6-10-17(11-7-15)26-27(22,23)24/h4-13H,3H3,(H,22,23,24)/b18-12-,19-13- |
| InChIKey | AFDVXUYMZKBPPT-BKHHGCLFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (21667925) | |
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (21667925) | Co-culture of fungus Aspergillus fumigatus with the bacteria streptomyces peucetius, BuOH extract. |
| Streptomyces peucetius (ncbitaxon:1950) | - | PubMed (21667925) | Co-culture of fungus Aspergillus fumigatus with the bacteria streptomyces peucetius, BuOH extract. |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BU-4704 (CHEBI:68208) has role Aspergillus metabolite (CHEBI:76956) |
| BU-4704 (CHEBI:68208) is a aromatic ether (CHEBI:35618) |
| BU-4704 (CHEBI:68208) is a aryl sulfate (CHEBI:37919) |
| BU-4704 (CHEBI:68208) is a isocyanide (CHEBI:35353) |
| IUPAC Name |
|---|
| 4-[(1Z,3Z)-2,3-diisocyano-4-(4-methoxyphenyl)buta-1,3-dien-1-yl]phenyl hydrogen sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21731183 | Reaxys |
| Citations |
|---|