EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N2O4 |
| Net Charge | 0 |
| Average Mass | 324.336 |
| Monoisotopic Mass | 324.11101 |
| SMILES | O=CNC(=C\c1ccc(O)cc1)/C(=C/c1ccc(O)cc1)NC=O |
| InChI | InChI=1S/C18H16N2O4/c21-11-19-17(9-13-1-5-15(23)6-2-13)18(20-12-22)10-14-3-7-16(24)8-4-14/h1-12,23-24H,(H,19,21)(H,20,22)/b17-9-,18-10- |
| InChIKey | ZNRFBLWRWQGBQX-XFQWXJFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (21667925) | From culture of Aspergillus fumigatus and also its coculture with streptomyces peucetius |
| Penicillium chrysogenum (ncbitaxon:5076) | - | PubMed (21667925) | |
| Streptomyces peucetius (ncbitaxon:1950) | - | PubMed (21667925) | Co-culture of fungus Aspergillus fumigatus with the bacteria streptomyces peucetius, BuOH extract. |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-((1Z,3Z)-1,4-bis(4-hydroxyphenyl)buta-1,3-diene-2,3-diyl)diformamide (CHEBI:68206) has role Aspergillus metabolite (CHEBI:76956) |
| N,N'-((1Z,3Z)-1,4-bis(4-hydroxyphenyl)buta-1,3-diene-2,3-diyl)diformamide (CHEBI:68206) is a phenylpropanoid (CHEBI:26004) |
| Citations |
|---|