EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O4 |
| Net Charge | 0 |
| Average Mass | 352.390 |
| Monoisotopic Mass | 352.14231 |
| SMILES | COc1ccc(/C=C(NC=O)/C(=C/c2ccc(OC)cc2)NC=O)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-25-17-7-3-15(4-8-17)11-19(21-13-23)20(22-14-24)12-16-5-9-18(26-2)10-6-16/h3-14H,1-2H3,(H,21,23)(H,22,24)/b19-11-,20-12- |
| InChIKey | ZRAIRHSUKMHHQT-YZLQMOBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (21667925) | From culture of Aspergillus fumigatus and also its coculture with streptomyces peucetius |
| Streptomyces peucetius (ncbitaxon:1950) | - | PubMed (21667925) | Co-culture of fungus Aspergillus fumigatus with the bacteria streptomyces peucetius, BuOH extract. |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-((1Z,3Z)-1,4-bis(4-methoxyphenyl)buta-1,3-diene-2,3-diyl)diformamide (CHEBI:68205) has role Aspergillus metabolite (CHEBI:76956) |
| N,N'-((1Z,3Z)-1,4-bis(4-methoxyphenyl)buta-1,3-diene-2,3-diyl)diformamide (CHEBI:68205) is a phenylpropanoid (CHEBI:26004) |
| Citations |
|---|