EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N2O7S |
| Net Charge | 0 |
| Average Mass | 418.427 |
| Monoisotopic Mass | 418.08347 |
| SMILES | COc1ccc(/C=C(NC=O)/C(=C/c2ccc(OS(=O)(=O)O)cc2)NC=O)cc1 |
| InChI | InChI=1S/C19H18N2O7S/c1-27-16-6-2-14(3-7-16)10-18(20-12-22)19(21-13-23)11-15-4-8-17(9-5-15)28-29(24,25)26/h2-13H,1H3,(H,20,22)(H,21,23)(H,24,25,26)/b18-10-,19-11- |
| InChIKey | RENNWVCPMZUVQU-BJPQZVBLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (21667925) | From culture of Aspergillus fumigatus and also its coculture with streptomyces peucetius |
| Streptomyces peucetius (ncbitaxon:1950) | - | PubMed (21667925) | Co-culture of fungus Aspergillus fumigatus with the bacteria streptomyces peucetius, BuOH extract |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fumiformamide (CHEBI:68204) has role Aspergillus metabolite (CHEBI:76956) |
| Fumiformamide (CHEBI:68204) is a phenylpropanoid (CHEBI:26004) |
| Synonym | Source |
|---|---|
| [4-[(1Z,3Z)-2,3-diformamido-4-(4-methoxyphenyl)buta-1,3-dienyl]phenyl]hydrogen sulfate | ChEBI |
| Citations |
|---|