EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N3O3 |
| Net Charge | 0 |
| Average Mass | 359.470 |
| Monoisotopic Mass | 359.22089 |
| SMILES | [H][C@]12C[C@]34C(=O)N(C)[C@]1(CN3CC[C@H]4C)C[C@@]1(CC(=O)N(C)C1=O)C2(C)C |
| InChI | InChI=1S/C20H29N3O3/c1-12-6-7-23-11-19-10-18(9-14(24)21(4)15(18)25)17(2,3)13(19)8-20(12,23)16(26)22(19)5/h12-13H,6-11H2,1-5H3/t12-,13-,18-,19+,20+/m1/s1 |
| InChIKey | RTNMRJRMTGSUAE-DWPFRNKMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | mycelium (BTO:0001436) | PubMed (21667999) | MeOH extract of macerated mycelia of fungus isolated from sponge Xesto-spongia testudinaria Strain: CRI323 04 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperparaline A (CHEBI:68203) has role Aspergillus metabolite (CHEBI:76956) |
| asperparaline A (CHEBI:68203) is a alkaloid (CHEBI:22315) |
| asperparaline A (CHEBI:68203) is a azaspiro compound (CHEBI:35624) |
| asperparaline A (CHEBI:68203) is a dicarboximide (CHEBI:35356) |
| IUPAC Name |
|---|
| (1R,5aR,7R,8aR,9aS)-1,1',8,8,11-pentamethyltetrahydro-1H,2'H,5'H,8H,10H-spiro[5a,9a-(epiminomethano)cyclopenta[f]indolizine-7,3'-pyrrolidine]-2',5',10-trione |
| Synonym | Source |
|---|---|
| aspergillimide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7888526 | Reaxys |
| Citations |
|---|