EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | [H][C@]12CC[C@@]3(O)C(=O)O[C@]4([H])C(=O)OC[C@@](C)(CC1(C)C)C234 |
| InChI | InChI=1S/C15H20O5/c1-12(2)6-13(3)7-19-10(16)9-15(13)8(12)4-5-14(15,18)11(17)20-9/h8-9,18H,4-7H2,1-3H3/t8-,9+,13+,14+,15?/m0/s1 |
| InChIKey | IOZFYMWZBPHFEH-WZQQFTANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | mycelium (BTO:0001436) | PubMed (21667999) | MeOH extract of macerated mycelia of fungus isolated from sponge Xesto-spongia testudinaria Strain: CRI323 04 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperaculin A (CHEBI:68202) has role Aspergillus metabolite (CHEBI:76956) |
| asperaculin A (CHEBI:68202) is a organic heterotetracyclic compound (CHEBI:38163) |
| asperaculin A (CHEBI:68202) is a sesquiterpene lactone (CHEBI:37667) |
| asperaculin A (CHEBI:68202) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| rel-(2aS,4aS,6aS,9aS)-2a-hydroxy-5,5,6a-trimethyloctahydro-2H-1,8-dioxapentaleno[1,6-cd]indene-2,9(9aH)-dione |
| Manual Xrefs | Databases |
|---|---|
| 26633263 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21729569 | Reaxys |
| Citations |
|---|