EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | C=C[C@]1(C)C=C2C(=O)C(O)=C3[C@](C)(CO)CC[C@@H](O)[C@]3(C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C20H28O5/c1-5-17(2)8-9-20(25)12(10-17)14(23)15(24)16-18(3,11-21)7-6-13(22)19(16,20)4/h5,10,13,21-22,24-25H,1,6-9,11H2,2-4H3/t13-,17+,18+,19+,20-/m1/s1 |
| InChIKey | YFSWTQQLSUEQBY-CNVPOBLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrinium sacchari (ncbitaxon:166626) | - | PubMed (21718054) | EtOAc extract of fermented wheat media of marine fungus(obtained from sponge surface) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Libertellenone C (CHEBI:68200) has role metabolite (CHEBI:25212) |
| Libertellenone C (CHEBI:68200) is a tricyclic diterpenoid (CHEBI:79084) |
| Synonym | Source |
|---|---|
| (1R,4R,4aR,4bS,7R)-7-ethenyl-4,4b,10-trihydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-3,4,5,6-tetrahydro-2H-phenanthren-9-one | ChEBI |
| Citations |
|---|