EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O6 |
| Net Charge | 0 |
| Average Mass | 358.390 |
| Monoisotopic Mass | 358.14164 |
| SMILES | [H][C@]12CC[C@@](C)(C(=O)O)C3=C(O)C(=O)C4=C[C@](C)(C=C)CC(=O)[C@@]4(O)[C@@]31C2 |
| InChI | InChI=1S/C20H22O6/c1-4-17(2)8-11-13(22)14(23)15-18(3,16(24)25)6-5-10-7-19(10,15)20(11,26)12(21)9-17/h4,8,10,23,26H,1,5-7,9H2,2-3H3,(H,24,25)/t10-,17+,18-,19-,20-/m1/s1 |
| InChIKey | XKJPVKHJPNQLKG-KPHJKFSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrinium sacchari (ncbitaxon:166626) | - | PubMed (21718054) | EtOAc extract of fermented wheat media of marine fungus(obtained from sponge surface) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myrocin A (CHEBI:68199) has role metabolite (CHEBI:25212) |
| Myrocin A (CHEBI:68199) is a tertiary alcohol (CHEBI:26878) |
| Citations |
|---|