EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O5 |
| Net Charge | 0 |
| Average Mass | 236.223 |
| Monoisotopic Mass | 236.06847 |
| SMILES | Cc1c(O)cc(O)c2c(=O)oc(CO)c(C)c12 |
| InChI | InChI=1S/C12H12O5/c1-5-7(14)3-8(15)11-10(5)6(2)9(4-13)17-12(11)16/h3,13-15H,4H2,1-2H3 |
| InChIKey | CBRPTHQFXQJGOV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrinium sacchari (ncbitaxon:166626) | - | PubMed (21718054) | EtOAc extract of fermented wheat media of marine fungus(obtained from sponge surface) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Decarboxyhydroxycitrinone (CHEBI:68198) has role metabolite (CHEBI:25212) |
| Decarboxyhydroxycitrinone (CHEBI:68198) is a isocoumarins (CHEBI:38758) |
| Synonym | Source |
|---|---|
| 6,8-dihydroxy-3-(hydroxymethyl)-4,5-dimethylisochromen-1-one | ChEBI |
| Citations |
|---|