EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | C=C[C@]1(C)C=C2C(=O)C3=C4[C@@](C)(CC[C@@H](O)[C@]4(C)[C@@]2(O)CC1)[C@@H](O)O3 |
| InChI | InChI=1S/C20H26O5/c1-5-17(2)8-9-20(24)11(10-17)13(22)14-15-18(3,16(23)25-14)7-6-12(21)19(15,20)4/h5,10,12,16,21,23-24H,1,6-9H2,2-4H3/t12-,16+,17+,18-,19+,20-/m1/s1 |
| InChIKey | HLWYVYSGPCXCSB-ROEDYFHJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrinium sacchari (ncbitaxon:166626) | - | PubMed (21718054) | EtOAc extract of fermented wheat media of marine fungus(obtained from sponge surface) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Libertellenone E (CHEBI:68196) has role metabolite (CHEBI:25212) |
| Libertellenone E (CHEBI:68196) is a dihydrofuran (CHEBI:51659) |
| Synonym | Source |
|---|---|
| (1beta,13alpha,18S)-1,9,18-Trihydroxy-6,18-epoxypimara-5,8(14),15-trien-7-one | ChEBI |
| Citations |
|---|