EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O5 |
| Net Charge | 0 |
| Average Mass | 344.407 |
| Monoisotopic Mass | 344.16237 |
| SMILES | [H][C@@]12CC[C@]3(C)C(=O)O[C@]4([H])[C@H](O)C5=C[C@@](C)(C=C)CC(=O)[C@]5(O)[C@]1(C2)[C@]34[H] |
| InChI | InChI=1S/C20H24O5/c1-4-17(2)8-11-13(22)14-15-18(3,16(23)25-14)6-5-10-7-19(10,15)20(11,24)12(21)9-17/h4,8,10,13-15,22,24H,1,5-7,9H2,2-3H3/t10-,13+,14+,15-,17+,18-,19-,20-/m0/s1 |
| InChIKey | BUKXEXVZJPKXME-POBLSUKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthrinium sacchari (ncbitaxon:166626) | - | PubMed (21718054) | CHCl3 extract of fermented wheat media of marine fungus(obtained from sponge surface) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myrocin D (CHEBI:68195) has role metabolite (CHEBI:25212) |
| Myrocin D (CHEBI:68195) is a γ-lactone (CHEBI:37581) |
| Citations |
|---|