EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | Cc1c(O)cc(O)c2c1COC2=O |
| InChI | InChI=1S/C9H8O4/c1-4-5-3-13-9(12)8(5)7(11)2-6(4)10/h2,10-11H,3H2,1H3 |
| InChIKey | GXYQICKPCCBIIX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavus (ncbitaxon:5059) | - | PubMed (4629904) | |
| Eurotium repens (ncbitaxon:41409) | - | PubMed (21667972) | EtOAc extract of Lyophilized fungus which was homogenized with acetone |
| Microascus tardifaciens (ncbitaxon:5594) | - | PubMed (10553639) | |
| Penicillium parvum (ncbitaxon:70113) | - | PubMed (18991460) |
| Roles Classification |
|---|
| Chemical Role: | impurity A chemical role played by any unwanted chemical substance inside a confined amount of liquid, gas, or solid, which differs from the chemical composition of the material or compound. For example, an impurity can be an undesired by-product of a chemical reaction or manufacturing process, a drug contaminant, or can be created upon degradation during storage. |
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,7-dihydroxy-4-methylphthalide (CHEBI:68194) has role Aspergillus metabolite (CHEBI:76956) |
| 5,7-dihydroxy-4-methylphthalide (CHEBI:68194) has role Penicillium metabolite (CHEBI:76964) |
| 5,7-dihydroxy-4-methylphthalide (CHEBI:68194) has role impurity (CHEBI:143130) |
| 5,7-dihydroxy-4-methylphthalide (CHEBI:68194) is a 2-benzofurans (CHEBI:38831) |
| 5,7-dihydroxy-4-methylphthalide (CHEBI:68194) is a phenols (CHEBI:33853) |
| 5,7-dihydroxy-4-methylphthalide (CHEBI:68194) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-4-methyl-2-benzofuran-1(3H)-one |
| Synonyms | Source |
|---|---|
| 3,5-dihydroxy-6-methylphthalide | ChEBI |
| 4-methyl-5,7-dihydroxyisobenzofuran-1(3H)-one | ChEBI |
| 5,7-dihydroxy-4-methyl-1,3-dihydro-2-benzofuran-1-one | ChEBI |
| 5,7-dihydroxy-4-methyl-1(3H)-isobenzofuranone | ChEBI |
| 5,7-dihydroxy-4-methyl-3H-2-benzofuran-1-one | ChEBI |
| 5,7-dihydroxy-4-methylisobenzofuran-1(3H)-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 5,7-dihydroxy-4-methylphthalide | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:27979-57-3 | ChemIDplus |
| Citations |
|---|